Products 198627-75-7

CAS 198627-75-7 is the registry number for tert-Butyl 4-(2-(piperazin-1-yl)ethyl)piperidine-1-carboxylate 98%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 4-(2-piperazin-1-ylethyl)piperidine-1-carboxylate (CAS 198627-75-7) is a chemical compound with the molecular formula C16H31N3O2 and a molecular weight of 297.44 g/mol. IUPAC name: tert-butyl 4-(2-piperazin-1-ylethyl)piperidine-1-carboxylate. InChIKey: OLXGQEDRTXGTEH-UHFFFAOYSA-N.

Identity
Molecular formulaC16H31N3O2
Molecular weight297.44 g/mol
IUPAC nametert-butyl 4-(2-piperazin-1-ylethyl)piperidine-1-carboxylate
InChIKeyOLXGQEDRTXGTEH-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(CC1)CCN2CCNCC2

Computed by PubChem (NCBI)