CAS 112699-07-7 appears in our catalog under these names: 5-Benzoyl-2-methoxybenzene-1-sulfonyl chloride, 97%, 5-Benzoyl-2-methoxy-benzenesulfonyl chloride. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 250mg.
5-benzoyl-2-methoxybenzenesulfonyl chloride (CAS 112699-07-7) is a chemical compound with the molecular formula C14H11ClO4S and a molecular weight of 310.8 g/mol. IUPAC name: 5-benzoyl-2-methoxybenzenesulfonyl chloride. InChIKey: DLLDKGCYIBQDQO-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO4S |
|---|---|
| Molecular weight | 310.8 g/mol |
| IUPAC name | 5-benzoyl-2-methoxybenzenesulfonyl chloride |
| InChIKey | DLLDKGCYIBQDQO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)C2=CC=CC=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)