CAS 69812-46-0 appears in our catalog under these names: benzyl 4-(chlorosulfonyl)benzoate, 95%, Benzyl 4-(chlorosulfonyl)benzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Benzyl 4-chlorosulfonylbenzoate (CAS 69812-46-0) is a chemical compound with the molecular formula C14H11ClO4S and a molecular weight of 310.8 g/mol. IUPAC name: benzyl 4-chlorosulfonylbenzoate. InChIKey: SNHZVLCTLMSLKW-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO4S |
|---|---|
| Molecular weight | 310.8 g/mol |
| IUPAC name | benzyl 4-chlorosulfonylbenzoate |
| InChIKey | SNHZVLCTLMSLKW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CC=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)