CAS 1127218-00-1 is the registry number for 2-(Iso-butyl)-5-(p-tolyl)thiazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g, 25g.
5-(4-methylphenyl)-2-(2-methylpropyl)-1,3-thiazole (CAS 1127218-00-1) is a chemical compound with the molecular formula C14H17NS and a molecular weight of 231.36 g/mol. IUPAC name: 5-(4-methylphenyl)-2-(2-methylpropyl)-1,3-thiazole. InChIKey: NSINOXXDOPWRCU-UHFFFAOYSA-N.
| Molecular formula | C14H17NS |
|---|---|
| Molecular weight | 231.36 g/mol |
| IUPAC name | 5-(4-methylphenyl)-2-(2-methylpropyl)-1,3-thiazole |
| InChIKey | NSINOXXDOPWRCU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CN=C(S2)CC(C)C |
Computed by PubChem (NCBI)