CAS 2760370-37-2 is the registry number for (2R,5S)-2-(Benzo[b]thiophen-5-yl)-5-methylpiperidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,5S)-2-(1-benzothiophen-5-yl)-5-methylpiperidine (CAS 2760370-37-2) is a chemical compound with the molecular formula C14H17NS and a molecular weight of 231.36 g/mol. IUPAC name: (2R,5S)-2-(1-benzothiophen-5-yl)-5-methylpiperidine. InChIKey: IQFUAXABMDMJAI-GXFFZTMASA-N.
| Molecular formula | C14H17NS |
|---|---|
| Molecular weight | 231.36 g/mol |
| IUPAC name | (2R,5S)-2-(1-benzothiophen-5-yl)-5-methylpiperidine |
| InChIKey | IQFUAXABMDMJAI-GXFFZTMASA-N |
| SMILES | C[C@H]1CC[C@@H](NC1)C2=CC3=C(C=C2)SC=C3 |
Computed by PubChem (NCBI)