CAS 112749-47-0 appears in our catalog under these names: 3,4-Dichloro-1-((2-fluorophenyl)methyl)-2,5-dihydro-1H-pyrrole-2,5-dione, 95%, 3,4-Dichloro-1-((2-fluorophenyl)methyl)-2,5-dihydro-1H-pyrrole-2,5-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
3,4-dichloro-1-[(2-fluorophenyl)methyl]pyrrole-2,5-dione (CAS 112749-47-0) is a chemical compound with the molecular formula C11H6Cl2FNO2 and a molecular weight of 274.07 g/mol. IUPAC name: 3,4-dichloro-1-[(2-fluorophenyl)methyl]pyrrole-2,5-dione. InChIKey: IRCGSNONKGXMRI-UHFFFAOYSA-N.
| Molecular formula | C11H6Cl2FNO2 |
|---|---|
| Molecular weight | 274.07 g/mol |
| IUPAC name | 3,4-dichloro-1-[(2-fluorophenyl)methyl]pyrrole-2,5-dione |
| InChIKey | IRCGSNONKGXMRI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN2C(=O)C(=C(C2=O)Cl)Cl)F |
Computed by PubChem (NCBI)