Products 1981582-48-2
CAS 1981582-48-2 is the registry number for Methyl 4,6-dichloro-8-fluoroquinoline-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4,6-dichloro-8-fluoroquinoline-3-carboxylate (CAS 1981582-48-2) is a chemical compound with the molecular formula C11H6Cl2FNO2 and a molecular weight of 274.07 g/mol. IUPAC name: methyl 4,6-dichloro-8-fluoroquinoline-3-carboxylate. InChIKey: HWYMJCPEZSSSLQ-UHFFFAOYSA-N.
| Molecular formula | C11H6Cl2FNO2 |
|---|---|
| Molecular weight | 274.07 g/mol |
| IUPAC name | methyl 4,6-dichloro-8-fluoroquinoline-3-carboxylate |
| InChIKey | HWYMJCPEZSSSLQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=C2C(=CC(=CC2=C1Cl)Cl)F |
Computed by PubChem (NCBI)