Products 112776-84-8
CAS 112776-84-8 appears in our catalog under these names: Dimethyl 4-iodopyridine-2,6-dicarboxylate 95%, Dimethyl 4-iodopyridine-2,6-dicarboxylate, 95%, 95%, Dimethyl 4-iodopyridine-2,6-dicarboxylate, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
Dimethyl 4-iodopyridine-2,6-dicarboxylate (CAS 112776-84-8) is a chemical compound with the molecular formula C9H8INO4 and a molecular weight of 321.07 g/mol. IUPAC name: dimethyl 4-iodopyridine-2,6-dicarboxylate. InChIKey: OIFGTELVXIXXQU-UHFFFAOYSA-N.
| Molecular formula | C9H8INO4 |
|---|---|
| Molecular weight | 321.07 g/mol |
| IUPAC name | dimethyl 4-iodopyridine-2,6-dicarboxylate |
| InChIKey | OIFGTELVXIXXQU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=N1)C(=O)OC)I |
Computed by PubChem (NCBI)