Products 57362-77-3
CAS 57362-77-3 is the registry number for Ethyl 4-iodo-3-nitrobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Ethyl 4-iodo-3-nitrobenzoate (CAS 57362-77-3) is a chemical compound with the molecular formula C9H8INO4 and a molecular weight of 321.07 g/mol. IUPAC name: ethyl 4-iodo-3-nitrobenzoate. InChIKey: KWCKGPNDVFZONO-UHFFFAOYSA-N.
| Molecular formula | C9H8INO4 |
|---|---|
| Molecular weight | 321.07 g/mol |
| IUPAC name | ethyl 4-iodo-3-nitrobenzoate |
| InChIKey | KWCKGPNDVFZONO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)I)[N+](=O)[O-] |
Computed by PubChem (NCBI)