Products 112810-02-3

CAS 112810-02-3 is the registry number for Methyl 2-(propane-2-sulfonyl)acetate. Offered by: Biosynth. Available pack sizes: 10g, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-propan-2-ylsulfonylacetate (CAS 112810-02-3) is a chemical compound with the molecular formula C6H12O4S and a molecular weight of 180.22 g/mol. IUPAC name: methyl 2-propan-2-ylsulfonylacetate. InChIKey: ZKWMTNKWNHSIHO-UHFFFAOYSA-N.

Identity
Molecular formulaC6H12O4S
Molecular weight180.22 g/mol
IUPAC namemethyl 2-propan-2-ylsulfonylacetate
InChIKeyZKWMTNKWNHSIHO-UHFFFAOYSA-N
SMILESCC(C)S(=O)(=O)CC(=O)OC

Computed by PubChem (NCBI)