CAS 112819-26-8 appears in our catalog under these names: 6-Bromo-2,3-dihydrothiochromen-1,1-dioxide-4-one, 95%, 6-Bromo-3,4-dihydro-2H-1lambda6-benzothiopyran-1,1,4-trione, 95%, 6-Bromo-2,3-dihydrothiochromen-1,1-dioxide-4-one, 6-Bromo-2,3-dihydro-4H-1-benzothiopyran-4-one 1,1-dioxide, 97%, 97%, 6-bromo-4-hydroxy-2H-1λâ¶-thiochromene-1,1-dione, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 2,5g.
6-bromo-1,1-dioxo-2,3-dihydrothiochromen-4-one (CAS 112819-26-8) is a chemical compound with the molecular formula C9H7BrO3S and a molecular weight of 275.12 g/mol. IUPAC name: 6-bromo-1,1-dioxo-2,3-dihydrothiochromen-4-one. InChIKey: ZIDGASJWZBLPDL-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO3S |
|---|---|
| Molecular weight | 275.12 g/mol |
| IUPAC name | 6-bromo-1,1-dioxo-2,3-dihydrothiochromen-4-one |
| InChIKey | ZIDGASJWZBLPDL-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)C2=C(C1=O)C=C(C=C2)Br |
Computed by PubChem (NCBI)