CAS 27720-87-2 is the registry number for 3-Bromothiochroman-4-one 1,1-dioxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-1,1-dioxo-2,3-dihydrothiochromen-4-one (CAS 27720-87-2) is a chemical compound with the molecular formula C9H7BrO3S and a molecular weight of 275.12 g/mol. IUPAC name: 3-bromo-1,1-dioxo-2,3-dihydrothiochromen-4-one. InChIKey: DEGLAKGDZIPTAY-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO3S |
|---|---|
| Molecular weight | 275.12 g/mol |
| IUPAC name | 3-bromo-1,1-dioxo-2,3-dihydrothiochromen-4-one |
| InChIKey | DEGLAKGDZIPTAY-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)C2=CC=CC=C2S1(=O)=O)Br |
Computed by PubChem (NCBI)