CAS 112835-62-8 appears in our catalog under these names: Ethyl 2-((1r,2s)-2-hydroxy-1,2-diphenylethylamino)acetate, 95%, Ethyl 2–(((1R,2S)–2–hydroxy–1,2–diphenylethyl)amino)acetate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 5g, 25g, 10g.
Ethyl 2-[[(1R,2S)-2-hydroxy-1,2-diphenylethyl]amino]acetate (CAS 112835-62-8) is a chemical compound with the molecular formula C18H21NO3 and a molecular weight of 299.4 g/mol. IUPAC name: ethyl 2-[[(1R,2S)-2-hydroxy-1,2-diphenylethyl]amino]acetate. InChIKey: LEAUHTMORLZYBA-MSOLQXFVSA-N.
| Molecular formula | C18H21NO3 |
|---|---|
| Molecular weight | 299.4 g/mol |
| IUPAC name | ethyl 2-[[(1R,2S)-2-hydroxy-1,2-diphenylethyl]amino]acetate |
| InChIKey | LEAUHTMORLZYBA-MSOLQXFVSA-N |
| SMILES | CCOC(=O)CN[C@H](C1=CC=CC=C1)[C@H](C2=CC=CC=C2)O |
Computed by PubChem (NCBI)