CAS 1624260-34-9 appears in our catalog under these names: 4-Isobutyramidonaphthalen-1-yl isobutyrate, 95%, 4-Isobutyramidonaphthalen-1-yl isobutyrate, 98%, 98%, 4-Isobutyramidonaphthalen-1-yl isobutyrate, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g.
[4-(2-methylpropanoylamino)naphthalen-1-yl] 2-methylpropanoate (CAS 1624260-34-9) is a chemical compound with the molecular formula C18H21NO3 and a molecular weight of 299.4 g/mol. IUPAC name: [4-(2-methylpropanoylamino)naphthalen-1-yl] 2-methylpropanoate. InChIKey: DRRZVYQAUIFWOU-UHFFFAOYSA-N.
| Molecular formula | C18H21NO3 |
|---|---|
| Molecular weight | 299.4 g/mol |
| IUPAC name | [4-(2-methylpropanoylamino)naphthalen-1-yl] 2-methylpropanoate |
| InChIKey | DRRZVYQAUIFWOU-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)NC1=CC=C(C2=CC=CC=C21)OC(=O)C(C)C |
Computed by PubChem (NCBI)