Products 112883-30-4
CAS 112883-30-4 is the registry number for L-Tyrosine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-N-methyl-, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-(4-hydroxyphenyl)propanoic acid (CAS 112883-30-4) is a chemical compound with the molecular formula C25H23NO5 and a molecular weight of 417.5 g/mol. IUPAC name: (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-(4-hydroxyphenyl)propanoic acid. InChIKey: WWYASALMEZOZPA-QHCPKHFHSA-N.
| Molecular formula | C25H23NO5 |
|---|---|
| Molecular weight | 417.5 g/mol |
| IUPAC name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-(4-hydroxyphenyl)propanoic acid |
| InChIKey | WWYASALMEZOZPA-QHCPKHFHSA-N |
| SMILES | CN([C@@H](CC1=CC=C(C=C1)O)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)