Products 1129-25-5
CAS 1129-25-5 appears in our catalog under these names: 4-(Methylthio)benzenesulfonyl chloride, 98%, 4–(methylthio)benzene–1–sulfonylchloride, 4-(Methylthio)benzenesulfonyl chloride, 95%. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 200mg.
4-methylsulfanylbenzenesulfonyl chloride (CAS 1129-25-5) is a chemical compound with the molecular formula C7H7ClO2S2 and a molecular weight of 222.7 g/mol. IUPAC name: 4-methylsulfanylbenzenesulfonyl chloride. InChIKey: ZCCHKGQZUSPUGJ-UHFFFAOYSA-N.
| Molecular formula | C7H7ClO2S2 |
|---|---|
| Molecular weight | 222.7 g/mol |
| IUPAC name | 4-methylsulfanylbenzenesulfonyl chloride |
| InChIKey | ZCCHKGQZUSPUGJ-UHFFFAOYSA-N |
| SMILES | CSC1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
4-(methylsulfanyl)benzene-1-sulfonyl chloride, 4-(Methylthio)benzenesulfonyl chloride, 4-(Methylthio)benzene-1-sulfonyl chloride, 4-methylsulfanylbenzenesulfonyl Chloride, 4-(methylsulfanyl)benzenesulfonyl chloride, Benzenesulfonyl chloride, 4-(methylthio)-, 4-(methylthio)benzenesulfonyl chloride(SALTDATA: FREE), 4-methylsulfanyl-benzenesulfonyl chloride, chloro(4-methylthiophenyl)sulfone, 4methylthiobenzenesulfonyl chloride