Products 60036-46-6

CAS 60036-46-6 appears in our catalog under these names: 3-(Methylsulfanyl)benzene-1-sulfonyl chloride, 95%, 3-(Methylsulfanyl)benzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

3-methylsulfanylbenzenesulfonyl chloride (CAS 60036-46-6) is a chemical compound with the molecular formula C7H7ClO2S2 and a molecular weight of 222.7 g/mol. IUPAC name: 3-methylsulfanylbenzenesulfonyl chloride. InChIKey: KBUQEVOIQNUKPC-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7ClO2S2
Molecular weight222.7 g/mol
IUPAC name3-methylsulfanylbenzenesulfonyl chloride
InChIKeyKBUQEVOIQNUKPC-UHFFFAOYSA-N
SMILESCSC1=CC(=CC=C1)S(=O)(=O)Cl

Computed by PubChem (NCBI)