CAS 1129291-47-9 is the registry number for m-Cresol Sulfate Potassium Salt. Offered by: TRC. Available pack sizes: 100mg, 250mg, 25mg.
Potassium (3-methylphenyl) sulfate (CAS 1129291-47-9) is a chemical compound with the molecular formula C7H7KO4S and a molecular weight of 226.29 g/mol. IUPAC name: potassium (3-methylphenyl) sulfate. InChIKey: XVVHJSGKLHOOJA-UHFFFAOYSA-M.
| Molecular formula | C7H7KO4S |
|---|---|
| Molecular weight | 226.29 g/mol |
| IUPAC name | potassium (3-methylphenyl) sulfate |
| InChIKey | XVVHJSGKLHOOJA-UHFFFAOYSA-M |
| SMILES | CC1=CC(=CC=C1)OS(=O)(=O)[O-].[K+] |
Computed by PubChem (NCBI)