CAS 91978-69-7 appears in our catalog under these names: Potassium p-tolyl sulfate, 95%, p-Tolyl Sulfate Potassium Salt, p-Cresyl sulfate potassium/ 99.97% (existing batch purity), p–Methylphenyl potassium sulfate, p-Tolyl Sulfate-d7 Potassium Salt. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 10g, 50mg, 100mg, 200mg, 10mM (in 1ml dmso), 250mg.
Potassium (4-methylphenyl) sulfate (CAS 91978-69-7) is a chemical compound with the molecular formula C7H7KO4S and a molecular weight of 226.29 g/mol. IUPAC name: potassium (4-methylphenyl) sulfate. InChIKey: HTSFIPMTBJHYFQ-UHFFFAOYSA-M.
| Molecular formula | C7H7KO4S |
|---|---|
| Molecular weight | 226.29 g/mol |
| IUPAC name | potassium (4-methylphenyl) sulfate |
| InChIKey | HTSFIPMTBJHYFQ-UHFFFAOYSA-M |
| SMILES | CC1=CC=C(C=C1)OS(=O)(=O)[O-].[K+] |
Computed by PubChem (NCBI)