CAS 1129540-71-1 appears in our catalog under these names: 3-Bromo-1-(4-nitrophenyl)-1h-1,2,4-triazole, 95%, 3-Bromo-1-(4-nitrophenyl)-1H-1,2,4-triazole, 97%, 3–BROMO–1–(4–NITROPHENYL)–1H–1,2,4–TRIAZOLE. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g.
3-bromo-1-(4-nitrophenyl)-1,2,4-triazole (CAS 1129540-71-1) is a chemical compound with the molecular formula C8H5BrN4O2 and a molecular weight of 269.05 g/mol. IUPAC name: 3-bromo-1-(4-nitrophenyl)-1,2,4-triazole. InChIKey: CMJIFYZIPZNUOY-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN4O2 |
|---|---|
| Molecular weight | 269.05 g/mol |
| IUPAC name | 3-bromo-1-(4-nitrophenyl)-1,2,4-triazole |
| InChIKey | CMJIFYZIPZNUOY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=NC(=N2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)