Products 1183804-10-5

CAS 1183804-10-5 is the registry number for 4-Bromo-2-(1H-1,2,3,4-tetrazol-1-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

4-bromo-2-(tetrazol-1-yl)benzoic acid (CAS 1183804-10-5) is a chemical compound with the molecular formula C8H5BrN4O2 and a molecular weight of 269.05 g/mol. IUPAC name: 4-bromo-2-(tetrazol-1-yl)benzoic acid. InChIKey: WLTHBSAFJXESRV-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5BrN4O2
Molecular weight269.05 g/mol
IUPAC name4-bromo-2-(tetrazol-1-yl)benzoic acid
InChIKeyWLTHBSAFJXESRV-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Br)N2C=NN=N2)C(=O)O

Computed by PubChem (NCBI)