CAS 1129541-11-2 is the registry number for 4-(3-(6-Methylpyridin-3-yl)-1H-1,2,4-triazol-1-yl)aniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[3-(6-methyl-3-pyridinyl)-1,2,4-triazol-1-yl]aniline (CAS 1129541-11-2) is a chemical compound with the molecular formula C14H13N5 and a molecular weight of 251.29 g/mol. IUPAC name: 4-[3-(6-methyl-3-pyridinyl)-1,2,4-triazol-1-yl]aniline. InChIKey: QLVYSVGBSCYXKJ-UHFFFAOYSA-N.
| Molecular formula | C14H13N5 |
|---|---|
| Molecular weight | 251.29 g/mol |
| IUPAC name | 4-[3-(6-methyl-3-pyridinyl)-1,2,4-triazol-1-yl]aniline |
| InChIKey | QLVYSVGBSCYXKJ-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(C=C1)C2=NN(C=N2)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)