CAS 147225-68-1 appears in our catalog under these names: Irbesartan Impurity 39, Losartan Impurity 14, Irbesartan Impurity 3, N-((2'-(1H-Tetrazol-5-Yl)(1,1'-Biphenyl)-4-Yl)Methyl)Amine, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methanamine (CAS 147225-68-1) is a chemical compound with the molecular formula C14H13N5 and a molecular weight of 251.29 g/mol. IUPAC name: [4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methanamine. InChIKey: QSRSXEHFQCQDRK-UHFFFAOYSA-N.
| Molecular formula | C14H13N5 |
|---|---|
| Molecular weight | 251.29 g/mol |
| IUPAC name | [4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methanamine |
| InChIKey | QSRSXEHFQCQDRK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)CN)C3=NNN=N3 |
Computed by PubChem (NCBI)