CAS 112966-16-2 appears in our catalog under these names: Tokinolide B, Tokinolide B, Tokinolide B, 98+%, 98+%, Tokinolide B, 98.44%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 5 mg, 1 mg.
(1S,2Z,7R,8R,9S)-2-butylidene-8-propylspiro[3-oxatricyclo[5.2.2.01,5]undec-5-ene-9,3'-4,5-dihydro-2-benzofuran]-1',4-dione (CAS 112966-16-2) is a chemical compound with the molecular formula C24H28O4 and a molecular weight of 380.5 g/mol. IUPAC name: (1S,2Z,7R,8R,9S)-2-butylidene-8-propylspiro[3-oxatricyclo[5.2.2.01,5]undec-5-ene-9,3'-4,5-dihydro-2-benzofuran]-1',4-dione. InChIKey: DZMFTLLDUYBHLI-MUSNRYMWSA-N.
| Molecular formula | C24H28O4 |
|---|---|
| Molecular weight | 380.5 g/mol |
| IUPAC name | (1S,2Z,7R,8R,9S)-2-butylidene-8-propylspiro[3-oxatricyclo[5.2.2.01,5]undec-5-ene-9,3'-4,5-dihydro-2-benzofuran]-1',4-dione |
| InChIKey | DZMFTLLDUYBHLI-MUSNRYMWSA-N |
| SMILES | CCC/C=C\1/[C@]23CC[C@H](C=C2C(=O)O1)[C@H]([C@]34C5=C(C=CCC5)C(=O)O4)CCC |
Computed by PubChem (NCBI)