CAS 130-80-3 appears in our catalog under these names: Hex-3-ene-3,4-diylbis(4,1-phenylene) dipropionate, 95+%, Diethylstilbestrol Impurity 1, Diethylstilbestrol Dipropionate, >95% (HPLC), Diethylstilbestrol dipropionate, Stilbestrol dipropionate. Offered by: Chemat Brand, Hubei YoungXin, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 500mg.
[4-[(E)-4-(4-propanoyloxyphenyl)hex-3-en-3-yl]phenyl] propanoate (CAS 130-80-3) is a chemical compound with the molecular formula C24H28O4 and a molecular weight of 380.5 g/mol. IUPAC name: [4-[(E)-4-(4-propanoyloxyphenyl)hex-3-en-3-yl]phenyl] propanoate. InChIKey: VZMLEMYJUIIHNF-QURGRASLSA-N.
| Molecular formula | C24H28O4 |
|---|---|
| Molecular weight | 380.5 g/mol |
| IUPAC name | [4-[(E)-4-(4-propanoyloxyphenyl)hex-3-en-3-yl]phenyl] propanoate |
| InChIKey | VZMLEMYJUIIHNF-QURGRASLSA-N |
| SMILES | CC/C(=C(/CC)\C1=CC=C(C=C1)OC(=O)CC)/C2=CC=C(C=C2)OC(=O)CC |
Computed by PubChem (NCBI)