CAS 1129683-83-5 appears in our catalog under these names: Sorafenib tosylate Impurity I, Sorafenib Impurity 3, 1-(4-Chloro-3-trifluoromethylphenyl)-3-(4-hydroxyphenyl)urea, >95% (HPLC), 1-(4-Chloro-3-trifluoromethylphenyl)-3-(4-hydroxyphenyl)urea. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 10mg, 50mg.
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(4-hydroxyphenyl)urea (CAS 1129683-83-5) is a chemical compound with the molecular formula C14H10ClF3N2O2 and a molecular weight of 330.69 g/mol. IUPAC name: 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(4-hydroxyphenyl)urea. InChIKey: QKJVYCOMRSLHGX-UHFFFAOYSA-N.
| Molecular formula | C14H10ClF3N2O2 |
|---|---|
| Molecular weight | 330.69 g/mol |
| IUPAC name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(4-hydroxyphenyl)urea |
| InChIKey | QKJVYCOMRSLHGX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)NC2=CC(=C(C=C2)Cl)C(F)(F)F)O |
Computed by PubChem (NCBI)