CAS 2680838-34-8 is the registry number for Benzyl (6-chloro-2-(trifluoromethyl)pyridin-3-yl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl N-[6-chloro-2-(trifluoromethyl)-3-pyridinyl]carbamate (CAS 2680838-34-8) is a chemical compound with the molecular formula C14H10ClF3N2O2 and a molecular weight of 330.69 g/mol. IUPAC name: benzyl N-[6-chloro-2-(trifluoromethyl)-3-pyridinyl]carbamate. InChIKey: PMGWYJJANFEFHW-UHFFFAOYSA-N.
| Molecular formula | C14H10ClF3N2O2 |
|---|---|
| Molecular weight | 330.69 g/mol |
| IUPAC name | benzyl N-[6-chloro-2-(trifluoromethyl)-3-pyridinyl]carbamate |
| InChIKey | PMGWYJJANFEFHW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC2=C(N=C(C=C2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)