CAS 1130-23-0 is the registry number for Cyclobutyrol (sodium). Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium 2-(1-hydroxycyclohexyl)butanoate (CAS 1130-23-0) is a chemical compound with the molecular formula C10H17NaO3 and a molecular weight of 208.23 g/mol. IUPAC name: sodium 2-(1-hydroxycyclohexyl)butanoate. InChIKey: ZIKJCAPMXXTMDD-UHFFFAOYSA-M.
| Molecular formula | C10H17NaO3 |
|---|---|
| Molecular weight | 208.23 g/mol |
| IUPAC name | sodium 2-(1-hydroxycyclohexyl)butanoate |
| InChIKey | ZIKJCAPMXXTMDD-UHFFFAOYSA-M |
| SMILES | CCC(C(=O)[O-])C1(CCCCC1)O.[Na+] |
Computed by PubChem (NCBI)