Products 1130050-35-9
CAS 1130050-35-9 appears in our catalog under these names: Ciprofloxacin-d8 , Ciprofloxacin-d8, Ciprofloxacin-d8, >95% (HPLC), Ciprofloxacin–d8, Ciprofloxacin-d8, 99.9%. Offered by: Hubei YoungXin, Chemat Brand, TRC, TargetMol, GLPBio. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 2,5mg, 1mg.
1-cyclopropyl-6-fluoro-7-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid (CAS 1130050-35-9) is a chemical compound with the molecular formula C17H18FN3O3 and a molecular weight of 339.39 g/mol. IUPAC name: 1-cyclopropyl-6-fluoro-7-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid. InChIKey: MYSWGUAQZAJSOK-SQUIKQQTSA-N.
| Molecular formula | C17H18FN3O3 |
|---|---|
| Molecular weight | 339.39 g/mol |
| IUPAC name | 1-cyclopropyl-6-fluoro-7-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid |
| InChIKey | MYSWGUAQZAJSOK-SQUIKQQTSA-N |
| SMILES | [2H]C1(C(N(C(C(N1)([2H])[2H])([2H])[2H])C2=C(C=C3C(=C2)N(C=C(C3=O)C(=O)O)C4CC4)F)([2H])[2H])[2H] |
Computed by PubChem (NCBI)