Products 2657645-00-4
CAS 2657645-00-4 is the registry number for N-Nitroso Safinamide, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
(2S)-2-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl-nitrosoamino]propanamide (CAS 2657645-00-4) is a chemical compound with the molecular formula C17H18FN3O3 and a molecular weight of 331.34 g/mol. IUPAC name: (2S)-2-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl-nitrosoamino]propanamide. InChIKey: NHMOTQHRSJIDDY-LBPRGKRZSA-N.
| Molecular formula | C17H18FN3O3 |
|---|---|
| Molecular weight | 331.34 g/mol |
| IUPAC name | (2S)-2-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl-nitrosoamino]propanamide |
| InChIKey | NHMOTQHRSJIDDY-LBPRGKRZSA-N |
| SMILES | C[C@@H](C(=O)N)N(CC1=CC=C(C=C1)OCC2=CC(=CC=C2)F)N=O |
Computed by PubChem (NCBI)