Products 113052-10-1
CAS 113052-10-1 is the registry number for 5-Acetyl Imazapyr. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 25mg, 10mg, 50mg, 100mg.
5-acetyl-2-(4-methyl-5-oxo-4-propan-2-yl-1H-imidazol-2-yl)pyridine-3-carboxylic acid (CAS 113052-10-1) is a chemical compound with the molecular formula C15H17N3O4 and a molecular weight of 303.31 g/mol. IUPAC name: 5-acetyl-2-(4-methyl-5-oxo-4-propan-2-yl-1H-imidazol-2-yl)pyridine-3-carboxylic acid. InChIKey: QSMRKLGBLCDQMK-UHFFFAOYSA-N.
| Molecular formula | C15H17N3O4 |
|---|---|
| Molecular weight | 303.31 g/mol |
| IUPAC name | 5-acetyl-2-(4-methyl-5-oxo-4-propan-2-yl-1H-imidazol-2-yl)pyridine-3-carboxylic acid |
| InChIKey | QSMRKLGBLCDQMK-UHFFFAOYSA-N |
| SMILES | CC(C)C1(C(=O)NC(=N1)C2=C(C=C(C=N2)C(=O)C)C(=O)O)C |
Computed by PubChem (NCBI)