CAS 1131-64-2 is the registry number for Debrisoquin. Offered by: MedChemExpress. Available pack sizes: 1 mg, 25 mg.
Debrisoquin is a member of isoquinolines and a carboxamidine. It has a role as an antihypertensive agent, an adrenergic agent, a sympatholytic agent and a human metabolite.
Source: ChEBI
| Molecular formula | C10H13N3 |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 3,4-dihydro-1H-isoquinoline-2-carboximidamide |
| InChIKey | JWPGJSVJDAJRLW-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=CC=CC=C21)C(=N)N |
Computed by PubChem (NCBI)