CAS 1131220-37-5 is the registry number for tert-Butyl (S)-2-(4-bromophenyl)morpholine-4-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl (2S)-2-(4-bromophenyl)morpholine-4-carboxylate (CAS 1131220-37-5) is a chemical compound with the molecular formula C15H20BrNO3 and a molecular weight of 342.23 g/mol. IUPAC name: tert-butyl (2S)-2-(4-bromophenyl)morpholine-4-carboxylate. InChIKey: UUIDDBRUOCXTAO-CYBMUJFWSA-N.
| Molecular formula | C15H20BrNO3 |
|---|---|
| Molecular weight | 342.23 g/mol |
| IUPAC name | tert-butyl (2S)-2-(4-bromophenyl)morpholine-4-carboxylate |
| InChIKey | UUIDDBRUOCXTAO-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCO[C@H](C1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)