CAS 1131220-82-0 appears in our catalog under these names: tert-Butyl 2-(4-bromophenyl)morpholine-4-carboxylate, 98+%, tert-Butyl 2-(4-bromophenyl)morpholine-4-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Tert-butyl 2-(4-bromophenyl)morpholine-4-carboxylate (CAS 1131220-82-0) is a chemical compound with the molecular formula C15H20BrNO3 and a molecular weight of 342.23 g/mol. IUPAC name: tert-butyl 2-(4-bromophenyl)morpholine-4-carboxylate. InChIKey: UUIDDBRUOCXTAO-UHFFFAOYSA-N.
| Molecular formula | C15H20BrNO3 |
|---|---|
| Molecular weight | 342.23 g/mol |
| IUPAC name | tert-butyl 2-(4-bromophenyl)morpholine-4-carboxylate |
| InChIKey | UUIDDBRUOCXTAO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC(C1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)