CAS 1131614-65-7 is the registry number for Methyl 3-iodo-4-(trifluoromethoxy)benzoate, 98%. Offered by: AmBeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Methyl 3-iodo-4-(trifluoromethoxy)benzoate (CAS 1131614-65-7) is a chemical compound with the molecular formula C9H6F3IO3 and a molecular weight of 346.04 g/mol. IUPAC name: methyl 3-iodo-4-(trifluoromethoxy)benzoate. InChIKey: GDNJYOSXXLIZBO-UHFFFAOYSA-N.
| Molecular formula | C9H6F3IO3 |
|---|---|
| Molecular weight | 346.04 g/mol |
| IUPAC name | methyl 3-iodo-4-(trifluoromethoxy)benzoate |
| InChIKey | GDNJYOSXXLIZBO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)OC(F)(F)F)I |
Computed by PubChem (NCBI)