Products 1131614-66-8

CAS 1131614-66-8 is the registry number for 3-Iodo-4-(2,2,2-trifluoroethoxy)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-iodo-4-(2,2,2-trifluoroethoxy)benzoic acid (CAS 1131614-66-8) is a chemical compound with the molecular formula C9H6F3IO3 and a molecular weight of 346.04 g/mol. IUPAC name: 3-iodo-4-(2,2,2-trifluoroethoxy)benzoic acid. InChIKey: ZUBLVRMZPQMTSS-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6F3IO3
Molecular weight346.04 g/mol
IUPAC name3-iodo-4-(2,2,2-trifluoroethoxy)benzoic acid
InChIKeyZUBLVRMZPQMTSS-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(=O)O)I)OCC(F)(F)F

Computed by PubChem (NCBI)