CAS 1132641-22-5 appears in our catalog under these names: Rosiglitazone–d3, Rosiglitazone-d3, Rosiglitazone-d3, >95% (HPLC), Rosiglitazone-d3, 97.20%. Offered by: GLPBio, Chemat Brand, TRC, MedChemExpress. Available pack sizes: 5mg, on request, 1mg, 1 mg.
5-[[4-[2-[pyridin-2-yl(trideuteriomethyl)amino]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (CAS 1132641-22-5) is a chemical compound with the molecular formula C18H19N3O3S and a molecular weight of 360.4 g/mol. IUPAC name: 5-[[4-[2-[pyridin-2-yl(trideuteriomethyl)amino]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione. InChIKey: YASAKCUCGLMORW-FIBGUPNXSA-N.
| Molecular formula | C18H19N3O3S |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 5-[[4-[2-[pyridin-2-yl(trideuteriomethyl)amino]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| InChIKey | YASAKCUCGLMORW-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N(CCOC1=CC=C(C=C1)CC2C(=O)NC(=O)S2)C3=CC=CC=N3 |
Computed by PubChem (NCBI)