CAS 78439-89-1 is the registry number for N-(1,5-Dimethyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)-4-methylbenzenesulfonamide, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 5mg, 25mg, 50mg, 100mg.
N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-4-methylbenzenesulfonamide (CAS 78439-89-1) is a chemical compound with the molecular formula C18H19N3O3S and a molecular weight of 357.4 g/mol. IUPAC name: N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-4-methylbenzenesulfonamide. InChIKey: NNMNPMAXQJPMDB-UHFFFAOYSA-N.
| Molecular formula | C18H19N3O3S |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-4-methylbenzenesulfonamide |
| InChIKey | NNMNPMAXQJPMDB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=C(N(N(C2=O)C3=CC=CC=C3)C)C |
Computed by PubChem (NCBI)