CAS 1132647-39-2 is the registry number for 2-Azido-1-(piperidin-1-yl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-azido-1-piperidin-1-ylethanone (CAS 1132647-39-2) is a chemical compound with the molecular formula C7H12N4O and a molecular weight of 168.20 g/mol. IUPAC name: 2-azido-1-piperidin-1-ylethanone. InChIKey: VLKMRAIOOAUYJW-UHFFFAOYSA-N.
| Molecular formula | C7H12N4O |
|---|---|
| Molecular weight | 168.20 g/mol |
| IUPAC name | 2-azido-1-piperidin-1-ylethanone |
| InChIKey | VLKMRAIOOAUYJW-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)CN=[N+]=[N-] |
Computed by PubChem (NCBI)