Products 113269-07-1
CAS 113269-07-1 appears in our catalog under these names: 4-Bromo-5-nitrobenzene-1,2-diamine, 95%, 4-Bromo-5-nitrobenzene-1,2-diamine, 95%+. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 25mg.
4-bromo-5-nitrobenzene-1,2-diamine (CAS 113269-07-1) is a chemical compound with the molecular formula C6H6BrN3O2 and a molecular weight of 232.03 g/mol. IUPAC name: 4-bromo-5-nitrobenzene-1,2-diamine. InChIKey: XGXKPRVKQPWQOY-UHFFFAOYSA-N.
| Molecular formula | C6H6BrN3O2 |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | 4-bromo-5-nitrobenzene-1,2-diamine |
| InChIKey | XGXKPRVKQPWQOY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])Br)N)N |
Computed by PubChem (NCBI)