CAS 1132773-28-4 is the registry number for 1-Ethyl-1,2,3,4-tetrahydro-6-(2-(4-nitrophenyl)diazenyl)-7-quinolinol. Offered by: TRC. Available pack sizes: 25mg.
1-ethyl-6-[(4-nitrophenyl)diazenyl]-3,4-dihydro-2H-quinolin-7-ol (CAS 1132773-28-4) is a chemical compound with the molecular formula C17H18N4O3 and a molecular weight of 326.35 g/mol. IUPAC name: 1-ethyl-6-[(4-nitrophenyl)diazenyl]-3,4-dihydro-2H-quinolin-7-ol. InChIKey: BBCJPEJOAMOQCH-UHFFFAOYSA-N.
| Molecular formula | C17H18N4O3 |
|---|---|
| Molecular weight | 326.35 g/mol |
| IUPAC name | 1-ethyl-6-[(4-nitrophenyl)diazenyl]-3,4-dihydro-2H-quinolin-7-ol |
| InChIKey | BBCJPEJOAMOQCH-UHFFFAOYSA-N |
| SMILES | CCN1CCCC2=CC(=C(C=C21)O)N=NC3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)