Products 89790-87-4
CAS 89790-87-4 is the registry number for WYE-179397-10mMinDMSO,,, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg.
(4-amino-3-nitrophenyl)-(4-phenylpiperazin-1-yl)methanone (CAS 89790-87-4) is a chemical compound with the molecular formula C17H18N4O3 and a molecular weight of 326.35 g/mol. IUPAC name: (4-amino-3-nitrophenyl)-(4-phenylpiperazin-1-yl)methanone. InChIKey: JKCPDHKFBMFYHO-UHFFFAOYSA-N.
| Molecular formula | C17H18N4O3 |
|---|---|
| Molecular weight | 326.35 g/mol |
| IUPAC name | (4-amino-3-nitrophenyl)-(4-phenylpiperazin-1-yl)methanone |
| InChIKey | JKCPDHKFBMFYHO-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=CC=CC=C2)C(=O)C3=CC(=C(C=C3)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)