CAS 1132970-43-4 is the registry number for Dihydro Astrophloxine. Offered by: TRC. Available pack sizes: 1mg, 2,5mg, 5mg.
(2E)-1-ethyl-2-[(E)-3-(1-ethyl-3,3-dimethyl-2H-indol-2-yl)prop-2-enylidene]-3,3-dimethylindole (CAS 1132970-43-4) is a chemical compound with the molecular formula C27H34N2 and a molecular weight of 386.6 g/mol. IUPAC name: (2E)-1-ethyl-2-[(E)-3-(1-ethyl-3,3-dimethyl-2H-indol-2-yl)prop-2-enylidene]-3,3-dimethylindole. InChIKey: LCCNORCLQFTDDF-KFTWTFIKSA-N.
| Molecular formula | C27H34N2 |
|---|---|
| Molecular weight | 386.6 g/mol |
| IUPAC name | (2E)-1-ethyl-2-[(E)-3-(1-ethyl-3,3-dimethyl-2H-indol-2-yl)prop-2-enylidene]-3,3-dimethylindole |
| InChIKey | LCCNORCLQFTDDF-KFTWTFIKSA-N |
| SMILES | CCN1C(C(C2=CC=CC=C21)(C)C)/C=C/C=C/3\C(C4=CC=CC=C4N3CC)(C)C |
Computed by PubChem (NCBI)