CAS 2757731-50-1 is the registry number for N1,N3-Bis(4-(tert-butyl)phenyl)-5-methylbenzene-1,3-diamine, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g.
1-N,3-N-bis(4-tert-butylphenyl)-5-methylbenzene-1,3-diamine (CAS 2757731-50-1) is a chemical compound with the molecular formula C27H34N2 and a molecular weight of 386.6 g/mol. IUPAC name: 1-N,3-N-bis(4-tert-butylphenyl)-5-methylbenzene-1,3-diamine. InChIKey: UHOSBNLELOWPRA-UHFFFAOYSA-N.
| Molecular formula | C27H34N2 |
|---|---|
| Molecular weight | 386.6 g/mol |
| IUPAC name | 1-N,3-N-bis(4-tert-butylphenyl)-5-methylbenzene-1,3-diamine |
| InChIKey | UHOSBNLELOWPRA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)NC2=CC=C(C=C2)C(C)(C)C)NC3=CC=C(C=C3)C(C)(C)C |
Computed by PubChem (NCBI)