CAS 1133-54-6 is the registry number for Gliquidone Impurity 8. Offered by: Chemat Brand. Available pack sizes: on request.
6-methoxy-3,3-dimethyl-2H-inden-1-one (CAS 1133-54-6) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: 6-methoxy-3,3-dimethyl-2H-inden-1-one. InChIKey: YSDTWWGZZDDTHY-UHFFFAOYSA-N.
| Molecular formula | C12H14O2 |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | 6-methoxy-3,3-dimethyl-2H-inden-1-one |
| InChIKey | YSDTWWGZZDDTHY-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C2=C1C=CC(=C2)OC)C |
Computed by PubChem (NCBI)