Products 1133115-74-8
CAS 1133115-74-8 is the registry number for 1-BOC-4-(5-nitroquinolin-8-yl)piperazine, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
Tert-butyl 4-(5-nitroquinolin-8-yl)piperazine-1-carboxylate (CAS 1133115-74-8) is a chemical compound with the molecular formula C18H22N4O4 and a molecular weight of 358.4 g/mol. IUPAC name: tert-butyl 4-(5-nitroquinolin-8-yl)piperazine-1-carboxylate. InChIKey: CGGFQFNDYKSSJB-UHFFFAOYSA-N.
| Molecular formula | C18H22N4O4 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | tert-butyl 4-(5-nitroquinolin-8-yl)piperazine-1-carboxylate |
| InChIKey | CGGFQFNDYKSSJB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=C3C(=C(C=C2)[N+](=O)[O-])C=CC=N3 |
Computed by PubChem (NCBI)