CAS 26109-60-4 appears in our catalog under these names: N1,N6-bis(2-nitrophenyl)hexane-1,6-diamine, 95%, N(1),N(6)-Bis(2-nitrophenyl)-1,6-hexanediamine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg.
N,N'-bis(2-nitrophenyl)hexane-1,6-diamine (CAS 26109-60-4) is a chemical compound with the molecular formula C18H22N4O4 and a molecular weight of 358.4 g/mol. IUPAC name: N,N'-bis(2-nitrophenyl)hexane-1,6-diamine. InChIKey: RTUNBTSAIDJSCN-UHFFFAOYSA-N.
| Molecular formula | C18H22N4O4 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | N,N'-bis(2-nitrophenyl)hexane-1,6-diamine |
| InChIKey | RTUNBTSAIDJSCN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NCCCCCCNC2=CC=CC=C2[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)