Products 1133287-34-9
CAS 1133287-34-9 is the registry number for Napabucasin analogue. Offered by: MedChemExpress. Available pack sizes: Get quote.
4,9-dioxobenzo[f][1]benzofuran-2-carboxylic acid (CAS 1133287-34-9) is a chemical compound with the molecular formula C13H6O5 and a molecular weight of 242.18 g/mol. IUPAC name: 4,9-dioxobenzo[f][1]benzofuran-2-carboxylic acid. InChIKey: JHHXQQALJIOVBY-UHFFFAOYSA-N.
| Molecular formula | C13H6O5 |
|---|---|
| Molecular weight | 242.18 g/mol |
| IUPAC name | 4,9-dioxobenzo[f][1]benzofuran-2-carboxylic acid |
| InChIKey | JHHXQQALJIOVBY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)OC(=C3)C(=O)O |
Computed by PubChem (NCBI)