CAS 1146-73-2 is the registry number for 1,3-Dioxo-1H,3H-benzo[de]isochromene-6-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-8-carboxylic acid (CAS 1146-73-2) is a chemical compound with the molecular formula C13H6O5 and a molecular weight of 242.18 g/mol. IUPAC name: 2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-8-carboxylic acid. InChIKey: DVGKTVKVVIFKFP-UHFFFAOYSA-N.
| Molecular formula | C13H6O5 |
|---|---|
| Molecular weight | 242.18 g/mol |
| IUPAC name | 2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-8-carboxylic acid |
| InChIKey | DVGKTVKVVIFKFP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC3=C2C(=C1)C(=O)OC3=O)C(=O)O |
Computed by PubChem (NCBI)