CAS 113342-32-8 is the registry number for 5–(4–chloro–3–methylphenyl)–1H–pyrazole–3–carboxylic acid. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
3-(4-chloro-3-methylphenyl)-1H-pyrazole-5-carboxylic acid (CAS 113342-32-8) is a chemical compound with the molecular formula C11H9ClN2O2 and a molecular weight of 236.65 g/mol. IUPAC name: 3-(4-chloro-3-methylphenyl)-1H-pyrazole-5-carboxylic acid. InChIKey: DOURQYNJNHGVSM-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2O2 |
|---|---|
| Molecular weight | 236.65 g/mol |
| IUPAC name | 3-(4-chloro-3-methylphenyl)-1H-pyrazole-5-carboxylic acid |
| InChIKey | DOURQYNJNHGVSM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=NNC(=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)